About ethyl 2-phenyliminoacetate
ethyl 2-phenyliminoacetate (PubChem CID 7095267) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is ethyl 2-phenyliminoacetate.
Molecular Properties
| Compound Name | ethyl 2-phenyliminoacetate |
| PubChem CID | 7095267 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | ethyl 2-phenyliminoacetate |
| SMILES | CCOC(=O)/C=N/c1ccccc1 |
| InChI | InChI=1S/C10H11NO2/c1-2-13-10(12)8-11-9-6-4-3-5-7-9/h3-8H,2H2,1H3/b11-8+ |
| InChIKey | GIWMBICOBYIWDN-DHZHZOJOSA-N |
| XLogP | 1.95 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-phenyliminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-phenyliminoacetate?
The IUPAC name of ethyl 2-phenyliminoacetate (CID 7095267) is ethyl 2-phenyliminoacetate.
What is the SMILES notation for ethyl 2-phenyliminoacetate?
The canonical SMILES for ethyl 2-phenyliminoacetate is CCOC(=O)/C=N/c1ccccc1.
What is the InChIKey of ethyl 2-phenyliminoacetate?
The InChIKey is GIWMBICOBYIWDN-DHZHZOJOSA-N. The full InChI is InChI=1S/C10H11NO2/c1-2-13-10(12)8-11-9-6-4-3-5-7-9/h3-8H,2H2,1H3/b11-8+.
What are the key properties of ethyl 2-phenyliminoacetate?
ethyl 2-phenyliminoacetate has a molecular weight of 177.20 g/mol, XLogP of 1.95, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-phenyliminoacetate is sourced from PubChem (CID 7095267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).