C28H27O4P — CID 102240826
ethyl (1R)-2-oxo-1-[2-(triphenyl-λ5-phosphanylidene)acetyl]cyclopentane-1-carboxylate (PubChem CID 102240826) has the molecular formula C28H27O4P and a molecular weight of 458.49 g/mol. Its IUPAC name is ethyl (1R)-2-oxo-1-[2-(triphenyl-λ5-phosphanylidene)acetyl]cyclopentane-1-carboxylate.
| Compound Name | ethyl (1R)-2-oxo-1-[2-(triphenyl-λ5-phosphanylidene)acetyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 102240826 |
| Molecular Formula | C28H27O4P |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | ethyl (1R)-2-oxo-1-[2-(triphenyl-λ5-phosphanylidene)acetyl]cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(C(=O)C=P(c2ccccc2)(c2ccccc2)c2ccccc2)CCCC1=O |
| InChI | InChI=1S/C28H27O4P/c1-2-32-27(31)28(20-12-19-25(28)29)26(30)21-33(22-13-6-3-7-14-22,23-15-8-4-9-16-23)24-17-10-5-11-18-24/h3-11,13-18,21H,2,12,19-20H2,1H3/t28-/m1/s1 |
| InChIKey | RGDNQMUSZJJRCR-MUUNZHRXSA-N |
| XLogP | 3.65 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|