C18H22O4 — CID 10804320
ethyl (1R)-2-oxo-1-[(2R)-3-oxo-2-phenylbutyl]cyclopentane-1-carboxylate (PubChem CID 10804320) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is ethyl (1R)-2-oxo-1-[(2R)-3-oxo-2-phenylbutyl]cyclopentane-1-carboxylate.
| Compound Name | ethyl (1R)-2-oxo-1-[(2R)-3-oxo-2-phenylbutyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 10804320 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | ethyl (1R)-2-oxo-1-[(2R)-3-oxo-2-phenylbutyl]cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C[C@@H](C(C)=O)c2ccccc2)CCCC1=O |
| InChI | InChI=1S/C18H22O4/c1-3-22-17(21)18(11-7-10-16(18)20)12-15(13(2)19)14-8-5-4-6-9-14/h4-6,8-9,15H,3,7,10-12H2,1-2H3/t15-,18+/m0/s1 |
| InChIKey | MBEOMANOSBCKKT-MAUKXSAKSA-N |
| XLogP | 3.05 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|