C17H21N3O3Se — CID 14963536
ethyl 1-(3-azido-2-phenylselanylpropyl)-2-oxocyclopentane-1-carboxylate (PubChem CID 14963536) has the molecular formula C17H21N3O3Se and a molecular weight of 394.33 g/mol. Its IUPAC name is ethyl 1-(3-azido-2-phenylselanylpropyl)-2-oxocyclopentane-1-carboxylate.
| Compound Name | ethyl 1-(3-azido-2-phenylselanylpropyl)-2-oxocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 14963536 |
| Molecular Formula | C17H21N3O3Se |
| Molecular Weight | 394.33 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | ethyl 1-(3-azido-2-phenylselanylpropyl)-2-oxocyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1(CC(CN=[N+]=[N-])[Se]c2ccccc2)CCCC1=O |
| InChI | InChI=1S/C17H21N3O3Se/c1-2-23-16(22)17(10-6-9-15(17)21)11-14(12-19-20-18)24-13-7-4-3-5-8-13/h3-5,7-8,14H,2,6,9-12H2,1H3 |
| InChIKey | PBMGDXVWSAOCAL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|