C14H17NO3 — CID 122404130
ethyl 1-anilino-2-oxocyclopentane-1-carboxylate (PubChem CID 122404130) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is ethyl 1-anilino-2-oxocyclopentane-1-carboxylate.
| Compound Name | ethyl 1-anilino-2-oxocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 122404130 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | ethyl 1-anilino-2-oxocyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1(Nc2ccccc2)CCCC1=O |
| InChI | InChI=1S/C14H17NO3/c1-2-18-13(17)14(10-6-9-12(14)16)15-11-7-4-3-5-8-11/h3-5,7-8,15H,2,6,9-10H2,1H3 |
| InChIKey | LPVNGLUEVXXAPS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|