C30H37O3PSi — CID 174911876
[tert-butyl(dimethyl)silyl] 5-oxo-6-(triphenyl-λ5-phosphanylidene)hexanoate (PubChem CID 174911876) has the molecular formula C30H37O3PSi and a molecular weight of 504.68 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 5-oxo-6-(triphenyl-λ5-phosphanylidene)hexanoate.
| Compound Name | [tert-butyl(dimethyl)silyl] 5-oxo-6-(triphenyl-λ5-phosphanylidene)hexanoate |
|---|---|
| PubChem CID | 174911876 |
| Molecular Formula | C30H37O3PSi |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 5-oxo-6-(triphenyl-λ5-phosphanylidene)hexanoate |
| SMILES | CC(C)(C)[Si](C)(C)OC(=O)CCCC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H37O3PSi/c1-30(2,3)35(4,5)33-29(32)23-15-16-25(31)24-34(26-17-9-6-10-18-26,27-19-11-7-12-20-27)28-21-13-8-14-22-28/h6-14,17-22,24H,15-16,23H2,1-5H3 |
| InChIKey | DQKTXVPRMHKLQX-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|