C31H39O4PSi — CID 87454435
(3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-oxo-6-(triphenyl-λ5-phosphanylidene)hexanoic acid (PubChem CID 87454435) has the molecular formula C31H39O4PSi and a molecular weight of 534.71 g/mol. Its IUPAC name is (3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-oxo-6-(triphenyl-λ5-phosphanylidene)hexanoic acid.
| Compound Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-oxo-6-(triphenyl-λ5-phosphanylidene)hexanoic acid |
|---|---|
| PubChem CID | 87454435 |
| Molecular Formula | C31H39O4PSi |
| Molecular Weight | 534.71 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-oxo-6-(triphenyl-λ5-phosphanylidene)hexanoic acid |
| SMILES | CC(C(=O)O)[C@@H](CC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H39O4PSi/c1-24(30(33)34)29(35-37(5,6)31(2,3)4)22-25(32)23-36(26-16-10-7-11-17-26,27-18-12-8-13-19-27)28-20-14-9-15-21-28/h7-21,23-24,29H,22H2,1-6H3,(H,33,34)/t24?,29-/m1/s1 |
| InChIKey | PKPFHUHMCZDZLP-HOINCLMKSA-N |
| XLogP | 5.85 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.71 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|