C32H52O4Si2 — CID 134871223
(2R,3S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-3-[tert-butyl(diphenyl)silyl]oxy-2-methylnonanoic acid (PubChem CID 134871223) has the molecular formula C32H52O4Si2 and a molecular weight of 556.94 g/mol. Its IUPAC name is (2R,3S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-3-[tert-butyl(diphenyl)silyl]oxy-2-methylnonanoic acid.
| Compound Name | (2R,3S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-3-[tert-butyl(diphenyl)silyl]oxy-2-methylnonanoic acid |
|---|---|
| PubChem CID | 134871223 |
| Molecular Formula | C32H52O4Si2 |
| Molecular Weight | 556.94 g/mol |
| Exact Mass | 556.34 |
| IUPAC Name | (2R,3S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-3-[tert-butyl(diphenyl)silyl]oxy-2-methylnonanoic acid |
| SMILES | CC[C@H](CCC[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](C)C(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H52O4Si2/c1-11-26(35-37(9,10)31(3,4)5)19-18-24-29(25(2)30(33)34)36-38(32(6,7)8,27-20-14-12-15-21-27)28-22-16-13-17-23-28/h12-17,20-23,25-26,29H,11,18-19,24H2,1-10H3,(H,33,34)/t25-,26-,29+/m1/s1 |
| InChIKey | TVXLNNFCSGBKDT-GEBXHLAXSA-N |
| XLogP | 7.62 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.94 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|