C35H58O4Si2 — CID 11135753
(2S,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-[(1R,2S)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxypropyl]decan-3-one (PubChem CID 11135753) has the molecular formula C35H58O4Si2 and a molecular weight of 599.02 g/mol. Its IUPAC name is (2S,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-[(1R,2S)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxypropyl]decan-3-one.
| Compound Name | (2S,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-[(1R,2S)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxypropyl]decan-3-one |
|---|---|
| PubChem CID | 11135753 |
| Molecular Formula | C35H58O4Si2 |
| Molecular Weight | 599.02 g/mol |
| Exact Mass | 598.39 |
| IUPAC Name | (2S,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-[(1R,2S)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxypropyl]decan-3-one |
| SMILES | CCCCCC[C@@H](C(=O)[C@H](C)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H58O4Si2/c1-12-13-14-21-26-31(32(36)27(2)38-40(10,11)34(4,5)6)33(37)28(3)39-41(35(7,8)9,29-22-17-15-18-23-29)30-24-19-16-20-25-30/h15-20,22-25,27-28,31,33,37H,12-14,21,26H2,1-11H3/t27-,28-,31-,33-/m0/s1 |
| InChIKey | FTBNNDWOAZXSSW-RWNSGJDNSA-N |
| XLogP | 7.88 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.02 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|