C27H38O2Si — CID 86716473
1-[tert-butyl(diphenyl)silyl]oxyundec-5-yn-1-ol (PubChem CID 86716473) has the molecular formula C27H38O2Si and a molecular weight of 422.69 g/mol. Its IUPAC name is 1-[tert-butyl(diphenyl)silyl]oxyundec-5-yn-1-ol.
| Compound Name | 1-[tert-butyl(diphenyl)silyl]oxyundec-5-yn-1-ol |
|---|---|
| PubChem CID | 86716473 |
| Molecular Formula | C27H38O2Si |
| Molecular Weight | 422.69 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | 1-[tert-butyl(diphenyl)silyl]oxyundec-5-yn-1-ol |
| SMILES | CCCCCC#CCCCC(O)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H38O2Si/c1-5-6-7-8-9-10-11-18-23-26(28)29-30(27(2,3)4,24-19-14-12-15-20-24)25-21-16-13-17-22-25/h12-17,19-22,26,28H,5-8,11,18,23H2,1-4H3 |
| InChIKey | AJSPWQTXKNPOSN-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.69 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|