C43H72OSi — CID 140673619
tert-butyl-[(Z)-heptacos-19-en-10-yl]oxy-diphenylsilane (PubChem CID 140673619) has the molecular formula C43H72OSi and a molecular weight of 633.13 g/mol. Its IUPAC name is tert-butyl-[(Z)-heptacos-19-en-10-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(Z)-heptacos-19-en-10-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 140673619 |
| Molecular Formula | C43H72OSi |
| Molecular Weight | 633.13 g/mol |
| Exact Mass | 632.54 |
| IUPAC Name | tert-butyl-[(Z)-heptacos-19-en-10-yl]oxy-diphenylsilane |
| SMILES | CCCCCCC/C=C\CCCCCCCCC(CCCCCCCCC)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C43H72OSi/c1-6-8-10-12-14-15-16-17-18-19-20-21-23-25-29-35-40(34-28-24-22-13-11-9-7-2)44-45(43(3,4)5,41-36-30-26-31-37-41)42-38-32-27-33-39-42/h16-17,26-27,30-33,36-40H,6-15,18-25,28-29,34-35H2,1-5H3/b17-16- |
| InChIKey | GXKAZRZQBCUMOP-MSUUIHNZSA-N |
| XLogP | 13.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.13 |
| LogP ≤ 5 | 13.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|