C47H74O6Si — CID 164754063
[(5Z,24Z)-15-[tert-butyl(diphenyl)silyl]oxy-29-formylperoxynonacosa-5,24-dienyl] formate (PubChem CID 164754063) has the molecular formula C47H74O6Si and a molecular weight of 763.19 g/mol. Its IUPAC name is [(5Z,24Z)-15-[tert-butyl(diphenyl)silyl]oxy-29-formylperoxynonacosa-5,24-dienyl] formate.
| Compound Name | [(5Z,24Z)-15-[tert-butyl(diphenyl)silyl]oxy-29-formylperoxynonacosa-5,24-dienyl] formate |
|---|---|
| PubChem CID | 164754063 |
| Molecular Formula | C47H74O6Si |
| Molecular Weight | 763.19 g/mol |
| Exact Mass | 762.53 |
| IUPAC Name | [(5Z,24Z)-15-[tert-butyl(diphenyl)silyl]oxy-29-formylperoxynonacosa-5,24-dienyl] formate |
| SMILES | CC(C)(C)[Si](OC(CCCCCCCC/C=C\CCCCOC=O)CCCCCCCC/C=C\CCCCOOC=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C47H74O6Si/c1-47(2,3)54(45-36-28-24-29-37-45,46-38-30-25-31-39-46)53-44(34-26-20-16-12-8-4-6-10-14-18-22-32-40-50-42-48)35-27-21-17-13-9-5-7-11-15-19-23-33-41-51-52-43-49/h10-11,14-15,24-25,28-31,36-39,42-44H,4-9,12-13,16-23,26-27,32-35,40-41H2,1-3H3/b14-10-,15-11- |
| InChIKey | SMSSHLQIWUABRU-HYQBVQLESA-N |
| XLogP | 11.90 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.19 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|