C35H40Br2OSi — CID 19825362
1,7-bis(4-bromophenyl)heptan-4-yloxy-tert-butyl-diphenylsilane (PubChem CID 19825362) has the molecular formula C35H40Br2OSi and a molecular weight of 664.60 g/mol. Its IUPAC name is 1,7-bis(4-bromophenyl)heptan-4-yloxy-tert-butyl-diphenylsilane.
| Compound Name | 1,7-bis(4-bromophenyl)heptan-4-yloxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 19825362 |
| Molecular Formula | C35H40Br2OSi |
| Molecular Weight | 664.60 g/mol |
| Exact Mass | 662.12 |
| IUPAC Name | 1,7-bis(4-bromophenyl)heptan-4-yloxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC(CCCc1ccc(Br)cc1)CCCc1ccc(Br)cc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H40Br2OSi/c1-35(2,3)39(33-16-6-4-7-17-33,34-18-8-5-9-19-34)38-32(14-10-12-28-20-24-30(36)25-21-28)15-11-13-29-22-26-31(37)27-23-29/h4-9,16-27,32H,10-15H2,1-3H3 |
| InChIKey | KRUKWMBIOPJLAY-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.60 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|