C35H40Br2O3Si — CID 162181674
3-[4-(bromomethyl)phenyl]propoxy-tert-butyl-diphenylsilane;3-(4-bromophenyl)propanoic acid (PubChem CID 162181674) has the molecular formula C35H40Br2O3Si and a molecular weight of 696.60 g/mol. Its IUPAC name is 3-[4-(bromomethyl)phenyl]propoxy-tert-butyl-diphenylsilane;3-(4-bromophenyl)propanoic acid.
| Compound Name | 3-[4-(bromomethyl)phenyl]propoxy-tert-butyl-diphenylsilane;3-(4-bromophenyl)propanoic acid |
|---|---|
| PubChem CID | 162181674 |
| Molecular Formula | C35H40Br2O3Si |
| Molecular Weight | 696.60 g/mol |
| Exact Mass | 694.11 |
| IUPAC Name | 3-[4-(bromomethyl)phenyl]propoxy-tert-butyl-diphenylsilane;3-(4-bromophenyl)propanoic acid |
| SMILES | CC(C)(C)[Si](OCCCc1ccc(CBr)cc1)(c1ccccc1)c1ccccc1.O=C(O)CCc1ccc(Br)cc1 |
| InChI | InChI=1S/C26H31BrOSi.C9H9BrO2/c1-26(2,3)29(24-12-6-4-7-13-24,25-14-8-5-9-15-25)28-20-10-11-22-16-18-23(21-27)19-17-22;10-8-4-1-7(2-5-8)3-6-9(11)12/h4-9,12-19H,10-11,20-21H2,1-3H3;1-2,4-5H,3,6H2,(H,11,12) |
| InChIKey | ZPCLOVVBFYHQGO-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.60 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|