C26H31BrOSi — CID 69439190
4-(3-bromophenyl)butoxy-tert-butyl-diphenylsilane (PubChem CID 69439190) has the molecular formula C26H31BrOSi and a molecular weight of 467.52 g/mol. Its IUPAC name is 4-(3-bromophenyl)butoxy-tert-butyl-diphenylsilane.
| Compound Name | 4-(3-bromophenyl)butoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 69439190 |
| Molecular Formula | C26H31BrOSi |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 4-(3-bromophenyl)butoxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCCCc1cccc(Br)c1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H31BrOSi/c1-26(2,3)29(24-16-6-4-7-17-24,25-18-8-5-9-19-25)28-20-11-10-13-22-14-12-15-23(27)21-22/h4-9,12,14-19,21H,10-11,13,20H2,1-3H3 |
| InChIKey | WBHZBQZJPITUDD-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|