C29H35BrO2Si — CID 23079270
5-bromo-2-[4-[tert-butyl(diphenyl)silyl]oxybutyl]-2,3-dihydro-1H-inden-1-ol (PubChem CID 23079270) has the molecular formula C29H35BrO2Si and a molecular weight of 523.59 g/mol. Its IUPAC name is 5-bromo-2-[4-[tert-butyl(diphenyl)silyl]oxybutyl]-2,3-dihydro-1H-inden-1-ol.
| Compound Name | 5-bromo-2-[4-[tert-butyl(diphenyl)silyl]oxybutyl]-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 23079270 |
| Molecular Formula | C29H35BrO2Si |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | 5-bromo-2-[4-[tert-butyl(diphenyl)silyl]oxybutyl]-2,3-dihydro-1H-inden-1-ol |
| SMILES | CC(C)(C)[Si](OCCCCC1Cc2cc(Br)ccc2C1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H35BrO2Si/c1-29(2,3)33(25-13-6-4-7-14-25,26-15-8-5-9-16-26)32-19-11-10-12-22-20-23-21-24(30)17-18-27(23)28(22)31/h4-9,13-18,21-22,28,31H,10-12,19-20H2,1-3H3 |
| InChIKey | CBYRBOFCUQZHAQ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|