C29H40O3Si — CID 11167187
(3aS,4S,6aR)-4-[6-[tert-butyl(diphenyl)silyl]oxyhexyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 11167187) has the molecular formula C29H40O3Si and a molecular weight of 464.72 g/mol. Its IUPAC name is (3aS,4S,6aR)-4-[6-[tert-butyl(diphenyl)silyl]oxyhexyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aS,4S,6aR)-4-[6-[tert-butyl(diphenyl)silyl]oxyhexyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 11167187 |
| Molecular Formula | C29H40O3Si |
| Molecular Weight | 464.72 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | (3aS,4S,6aR)-4-[6-[tert-butyl(diphenyl)silyl]oxyhexyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CC(C)(C)[Si](OCCCCCC[C@H]1CC[C@H]2OC(=O)C[C@@H]12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H40O3Si/c1-29(2,3)33(24-15-9-6-10-16-24,25-17-11-7-12-18-25)31-21-13-5-4-8-14-23-19-20-27-26(23)22-28(30)32-27/h6-7,9-12,15-18,23,26-27H,4-5,8,13-14,19-22H2,1-3H3/t23-,26-,27+/m0/s1 |
| InChIKey | LWTOVBNQZQKVCR-MSLLRLGPSA-N |
| XLogP | 5.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.72 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|