C23H28O4Si — CID 19358695
4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-2-one (PubChem CID 19358695) has the molecular formula C23H28O4Si and a molecular weight of 396.56 g/mol. Its IUPAC name is 4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-2-one.
| Compound Name | 4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-2-one |
|---|---|
| PubChem CID | 19358695 |
| Molecular Formula | C23H28O4Si |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-2-one |
| SMILES | CC(C)(C)[Si](OCC1OCC2OC(=O)CC12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H28O4Si/c1-23(2,3)28(17-10-6-4-7-11-17,18-12-8-5-9-13-18)26-16-20-19-14-22(24)27-21(19)15-25-20/h4-13,19-21H,14-16H2,1-3H3 |
| InChIKey | CTIVEMGKKMBHGO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|