C33H40O5Si — CID 11592011
(2R,4aR,6S,7R,9Z,10aS)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-9-methyl-2-phenyl-4,4a,6,7,8,10a-hexahydro-[1,3]dioxino[5,4-b]oxocin-7-ol (PubChem CID 11592011) has the molecular formula C33H40O5Si and a molecular weight of 544.76 g/mol. Its IUPAC name is (2R,4aR,6S,7R,9Z,10aS)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-9-methyl-2-phenyl-4,4a,6,7,8,10a-hexahydro-[1,3]dioxino[5,4-b]oxocin-7-ol.
| Compound Name | (2R,4aR,6S,7R,9Z,10aS)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-9-methyl-2-phenyl-4,4a,6,7,8,10a-hexahydro-[1,3]dioxino[5,4-b]oxocin-7-ol |
|---|---|
| PubChem CID | 11592011 |
| Molecular Formula | C33H40O5Si |
| Molecular Weight | 544.76 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | (2R,4aR,6S,7R,9Z,10aS)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-9-methyl-2-phenyl-4,4a,6,7,8,10a-hexahydro-[1,3]dioxino[5,4-b]oxocin-7-ol |
| SMILES | C/C1=C/[C@@H]2O[C@H](c3ccccc3)OC[C@H]2O[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](O)C1 |
| InChI | InChI=1S/C33H40O5Si/c1-24-20-28(34)30(37-31-22-35-32(38-29(31)21-24)25-14-8-5-9-15-25)23-36-39(33(2,3)4,26-16-10-6-11-17-26)27-18-12-7-13-19-27/h5-19,21,28-32,34H,20,22-23H2,1-4H3/b24-21-/t28-,29+,30+,31-,32-/m1/s1 |
| InChIKey | LLLRNWREUWXEDX-ZUYFKCLSSA-N |
| XLogP | 5.14 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.76 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|