C22H28O4Si — CID 11731767
(3R,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-4-methyloxolan-2-one (PubChem CID 11731767) has the molecular formula C22H28O4Si and a molecular weight of 384.55 g/mol. Its IUPAC name is (3R,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-4-methyloxolan-2-one.
| Compound Name | (3R,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-4-methyloxolan-2-one |
|---|---|
| PubChem CID | 11731767 |
| Molecular Formula | C22H28O4Si |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (3R,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-4-methyloxolan-2-one |
| SMILES | C[C@H]1[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(=O)[C@@H]1O |
| InChI | InChI=1S/C22H28O4Si/c1-16-19(26-21(24)20(16)23)15-25-27(22(2,3)4,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,16,19-20,23H,15H2,1-4H3/t16-,19+,20+/m0/s1 |
| InChIKey | CSKKAXYXSPNUQS-PWIZWCRZSA-N |
| XLogP | 2.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|