C25H36O4Si — CID 102393035
[(4R,5R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]methanol (PubChem CID 102393035) has the molecular formula C25H36O4Si and a molecular weight of 428.65 g/mol. Its IUPAC name is [(4R,5R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]methanol.
| Compound Name | [(4R,5R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]methanol |
|---|---|
| PubChem CID | 102393035 |
| Molecular Formula | C25H36O4Si |
| Molecular Weight | 428.65 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | [(4R,5R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]methanol |
| SMILES | C[C@@H]1[C@H](CO)OC(C)(C)O[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H36O4Si/c1-19-22(17-26)28-25(5,6)29-23(19)18-27-30(24(2,3)4,20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-16,19,22-23,26H,17-18H2,1-6H3/t19-,22+,23-/m1/s1 |
| InChIKey | MTOIATFFUAQHGO-WTIAFYNJSA-N |
| XLogP | 3.71 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.65 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|