C26H38O6Si — CID 91510832
[(2S,3S,5R,6R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]methanol (PubChem CID 91510832) has the molecular formula C26H38O6Si and a molecular weight of 474.67 g/mol. Its IUPAC name is [(2S,3S,5R,6R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]methanol.
| Compound Name | [(2S,3S,5R,6R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]methanol |
|---|---|
| PubChem CID | 91510832 |
| Molecular Formula | C26H38O6Si |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | [(2S,3S,5R,6R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]methanol |
| SMILES | CO[C@]1(C)O[C@@H](CO)[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@]1(C)OC |
| InChI | InChI=1S/C26H38O6Si/c1-24(2,3)33(20-14-10-8-11-15-20,21-16-12-9-13-17-21)30-19-23-22(18-27)31-25(4,28-6)26(5,29-7)32-23/h8-17,22-23,27H,18-19H2,1-7H3/t22-,23-,25+,26+/m0/s1 |
| InChIKey | FHFMDUZFFNVDQH-IHBRBHLJSA-N |
| XLogP | 3.06 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|