C22H30O3Si — CID 135021145
[(3S)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]oxiran-2-yl]methanol (PubChem CID 135021145) has the molecular formula C22H30O3Si and a molecular weight of 370.56 g/mol. Its IUPAC name is [(3S)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]oxiran-2-yl]methanol.
| Compound Name | [(3S)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 135021145 |
| Molecular Formula | C22H30O3Si |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | [(3S)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]oxiran-2-yl]methanol |
| SMILES | CC(C)(C)[Si](OCCC[C@@H]1OC1CO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H30O3Si/c1-22(2,3)26(18-11-6-4-7-12-18,19-13-8-5-9-14-19)24-16-10-15-20-21(17-23)25-20/h4-9,11-14,20-21,23H,10,15-17H2,1-3H3/t20-,21?/m0/s1 |
| InChIKey | BQVGEAMUMPAUCW-BGERDNNASA-N |
| XLogP | 3.10 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|