C26H36O2Si2 — CID 23240933
tert-butyl-diphenyl-[3-[(2R,3R)-3-(2-trimethylsilylethynyl)oxiran-2-yl]propoxy]silane (PubChem CID 23240933) has the molecular formula C26H36O2Si2 and a molecular weight of 436.74 g/mol. Its IUPAC name is tert-butyl-diphenyl-[3-[(2R,3R)-3-(2-trimethylsilylethynyl)oxiran-2-yl]propoxy]silane.
| Compound Name | tert-butyl-diphenyl-[3-[(2R,3R)-3-(2-trimethylsilylethynyl)oxiran-2-yl]propoxy]silane |
|---|---|
| PubChem CID | 23240933 |
| Molecular Formula | C26H36O2Si2 |
| Molecular Weight | 436.74 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | tert-butyl-diphenyl-[3-[(2R,3R)-3-(2-trimethylsilylethynyl)oxiran-2-yl]propoxy]silane |
| SMILES | CC(C)(C)[Si](OCCC[C@H]1O[C@@H]1C#C[Si](C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H36O2Si2/c1-26(2,3)30(22-14-9-7-10-15-22,23-16-11-8-12-17-23)27-20-13-18-24-25(28-24)19-21-29(4,5)6/h7-12,14-17,24-25H,13,18,20H2,1-6H3/t24-,25-/m1/s1 |
| InChIKey | WBANXGGYFZWLKX-JWQCQUIFSA-N |
| XLogP | 4.99 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.74 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|