C23H28O2Si — CID 73192940
tert-butyl-[4-(3-methyloxiran-2-yl)but-3-ynoxy]-diphenylsilane (PubChem CID 73192940) has the molecular formula C23H28O2Si and a molecular weight of 364.56 g/mol. Its IUPAC name is tert-butyl-[4-(3-methyloxiran-2-yl)but-3-ynoxy]-diphenylsilane.
| Compound Name | tert-butyl-[4-(3-methyloxiran-2-yl)but-3-ynoxy]-diphenylsilane |
|---|---|
| PubChem CID | 73192940 |
| Molecular Formula | C23H28O2Si |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | tert-butyl-[4-(3-methyloxiran-2-yl)but-3-ynoxy]-diphenylsilane |
| SMILES | CC1OC1C#CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H28O2Si/c1-19-22(25-19)17-11-12-18-24-26(23(2,3)4,20-13-7-5-8-14-20)21-15-9-6-10-16-21/h5-10,13-16,19,22H,12,18H2,1-4H3 |
| InChIKey | DUQWMOMXNARQGZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|