C22H28O2Si — CID 46854164
tert-butyl-[(E)-3-[(2S,3S)-3-methyloxiran-2-yl]prop-2-enoxy]-diphenylsilane (PubChem CID 46854164) has the molecular formula C22H28O2Si and a molecular weight of 352.55 g/mol. Its IUPAC name is tert-butyl-[(E)-3-[(2S,3S)-3-methyloxiran-2-yl]prop-2-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(E)-3-[(2S,3S)-3-methyloxiran-2-yl]prop-2-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 46854164 |
| Molecular Formula | C22H28O2Si |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | tert-butyl-[(E)-3-[(2S,3S)-3-methyloxiran-2-yl]prop-2-enoxy]-diphenylsilane |
| SMILES | C[C@@H]1O[C@H]1/C=C/CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C22H28O2Si/c1-18-21(24-18)16-11-17-23-25(22(2,3)4,19-12-7-5-8-13-19)20-14-9-6-10-15-20/h5-16,18,21H,17H2,1-4H3/b16-11+/t18-,21-/m0/s1 |
| InChIKey | HDCFNLPEEHGCBV-DSVFEOKZSA-N |
| XLogP | 3.91 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|