C22H28O2Si — CID 11089492
(E)-6-[tert-butyl(diphenyl)silyl]oxyhex-4-enal (PubChem CID 11089492) has the molecular formula C22H28O2Si and a molecular weight of 352.55 g/mol. Its IUPAC name is (E)-6-[tert-butyl(diphenyl)silyl]oxyhex-4-enal.
| Compound Name | (E)-6-[tert-butyl(diphenyl)silyl]oxyhex-4-enal |
|---|---|
| PubChem CID | 11089492 |
| Molecular Formula | C22H28O2Si |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (E)-6-[tert-butyl(diphenyl)silyl]oxyhex-4-enal |
| SMILES | CC(C)(C)[Si](OC/C=C/CCC=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H28O2Si/c1-22(2,3)25(20-14-8-6-9-15-20,21-16-10-7-11-17-21)24-19-13-5-4-12-18-23/h5-11,13-18H,4,12,19H2,1-3H3/b13-5+ |
| InChIKey | BWWQDACQMYMXMJ-WLRTZDKTSA-N |
| XLogP | 4.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|