C21H28O2Si — CID 25223642
(E,2R)-5-[tert-butyl(diphenyl)silyl]oxypent-3-en-2-ol (PubChem CID 25223642) has the molecular formula C21H28O2Si and a molecular weight of 340.54 g/mol. Its IUPAC name is (E,2R)-5-[tert-butyl(diphenyl)silyl]oxypent-3-en-2-ol.
| Compound Name | (E,2R)-5-[tert-butyl(diphenyl)silyl]oxypent-3-en-2-ol |
|---|---|
| PubChem CID | 25223642 |
| Molecular Formula | C21H28O2Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | (E,2R)-5-[tert-butyl(diphenyl)silyl]oxypent-3-en-2-ol |
| SMILES | C[C@@H](O)/C=C/CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C21H28O2Si/c1-18(22)12-11-17-23-24(21(2,3)4,19-13-7-5-8-14-19)20-15-9-6-10-16-20/h5-16,18,22H,17H2,1-4H3/b12-11+/t18-/m1/s1 |
| InChIKey | FHZUACJXXWDVHK-IENJSVCTSA-N |
| XLogP | 3.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|