C27H30F2O2Si — CID 101394418
(E)-5-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoro-1-phenylpent-3-en-1-ol (PubChem CID 101394418) has the molecular formula C27H30F2O2Si and a molecular weight of 452.62 g/mol. Its IUPAC name is (E)-5-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoro-1-phenylpent-3-en-1-ol.
| Compound Name | (E)-5-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoro-1-phenylpent-3-en-1-ol |
|---|---|
| PubChem CID | 101394418 |
| Molecular Formula | C27H30F2O2Si |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | (E)-5-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoro-1-phenylpent-3-en-1-ol |
| SMILES | CC(C)(C)[Si](OC/C=C/C(F)(F)C(O)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H30F2O2Si/c1-26(2,3)32(23-16-9-5-10-17-23,24-18-11-6-12-19-24)31-21-13-20-27(28,29)25(30)22-14-7-4-8-15-22/h4-20,25,30H,21H2,1-3H3/b20-13+ |
| InChIKey | GUSWDXIMTPAPMS-DEDYPNTBSA-N |
| XLogP | 5.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|