C26H28F2O2Si — CID 102228376
(E)-4-[tert-butyl(diphenyl)silyl]oxy-2-fluoro-1-(4-fluorophenyl)but-2-en-1-ol (PubChem CID 102228376) has the molecular formula C26H28F2O2Si and a molecular weight of 438.59 g/mol. Its IUPAC name is (E)-4-[tert-butyl(diphenyl)silyl]oxy-2-fluoro-1-(4-fluorophenyl)but-2-en-1-ol.
| Compound Name | (E)-4-[tert-butyl(diphenyl)silyl]oxy-2-fluoro-1-(4-fluorophenyl)but-2-en-1-ol |
|---|---|
| PubChem CID | 102228376 |
| Molecular Formula | C26H28F2O2Si |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | (E)-4-[tert-butyl(diphenyl)silyl]oxy-2-fluoro-1-(4-fluorophenyl)but-2-en-1-ol |
| SMILES | CC(C)(C)[Si](OC/C=C(/F)C(O)c1ccc(F)cc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H28F2O2Si/c1-26(2,3)31(22-10-6-4-7-11-22,23-12-8-5-9-13-23)30-19-18-24(28)25(29)20-14-16-21(27)17-15-20/h4-18,25,29H,19H2,1-3H3/b24-18+ |
| InChIKey | QVLLOOCUMFLIME-HKOYGPOVSA-N |
| XLogP | 5.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|