C26H36O3Si — CID 56600016
(E,2S)-5-[tert-butyl(diphenyl)silyl]oxy-1-(3,3-dimethyloxiran-2-yl)-3-methylpent-3-en-2-ol (PubChem CID 56600016) has the molecular formula C26H36O3Si and a molecular weight of 424.66 g/mol. Its IUPAC name is (E,2S)-5-[tert-butyl(diphenyl)silyl]oxy-1-(3,3-dimethyloxiran-2-yl)-3-methylpent-3-en-2-ol.
| Compound Name | (E,2S)-5-[tert-butyl(diphenyl)silyl]oxy-1-(3,3-dimethyloxiran-2-yl)-3-methylpent-3-en-2-ol |
|---|---|
| PubChem CID | 56600016 |
| Molecular Formula | C26H36O3Si |
| Molecular Weight | 424.66 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | (E,2S)-5-[tert-butyl(diphenyl)silyl]oxy-1-(3,3-dimethyloxiran-2-yl)-3-methylpent-3-en-2-ol |
| SMILES | C/C(=C\CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](O)CC1OC1(C)C |
| InChI | InChI=1S/C26H36O3Si/c1-20(23(27)19-24-26(5,6)29-24)17-18-28-30(25(2,3)4,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-17,23-24,27H,18-19H2,1-6H3/b20-17+/t23-,24?/m0/s1 |
| InChIKey | UTHFZBVMURHXII-GDNNXHTQSA-N |
| XLogP | 4.44 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.66 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|