C26H33NO2Si — CID 10993491
(E)-8-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-6-methyl-2-methylideneoct-6-enenitrile (PubChem CID 10993491) has the molecular formula C26H33NO2Si and a molecular weight of 419.64 g/mol. Its IUPAC name is (E)-8-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-6-methyl-2-methylideneoct-6-enenitrile.
| Compound Name | (E)-8-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-6-methyl-2-methylideneoct-6-enenitrile |
|---|---|
| PubChem CID | 10993491 |
| Molecular Formula | C26H33NO2Si |
| Molecular Weight | 419.64 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | (E)-8-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-6-methyl-2-methylideneoct-6-enenitrile |
| SMILES | C=C(C#N)C(O)CC/C(C)=C/CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H33NO2Si/c1-21(16-17-25(28)22(2)20-27)18-19-29-30(26(3,4)5,23-12-8-6-9-13-23)24-14-10-7-11-15-24/h6-15,18,25,28H,2,16-17,19H2,1,3-5H3/b21-18+ |
| InChIKey | ARLISLKAQGUPCL-DYTRJAOYSA-N |
| XLogP | 4.73 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.64 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|