C28H36OSi — CID 11362057
tert-butyl-diphenyl-[(2E,5S,6Z)-3,5,7-trimethylnona-2,6-dien-8-ynoxy]silane (PubChem CID 11362057) has the molecular formula C28H36OSi and a molecular weight of 416.68 g/mol. Its IUPAC name is tert-butyl-diphenyl-[(2E,5S,6Z)-3,5,7-trimethylnona-2,6-dien-8-ynoxy]silane.
| Compound Name | tert-butyl-diphenyl-[(2E,5S,6Z)-3,5,7-trimethylnona-2,6-dien-8-ynoxy]silane |
|---|---|
| PubChem CID | 11362057 |
| Molecular Formula | C28H36OSi |
| Molecular Weight | 416.68 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | tert-butyl-diphenyl-[(2E,5S,6Z)-3,5,7-trimethylnona-2,6-dien-8-ynoxy]silane |
| SMILES | C#C/C(C)=C\[C@@H](C)C/C(C)=C/CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H36OSi/c1-8-23(2)21-25(4)22-24(3)19-20-29-30(28(5,6)7,26-15-11-9-12-16-26)27-17-13-10-14-18-27/h1,9-19,21,25H,20,22H2,2-7H3/b23-21-,24-19+/t25-/m1/s1 |
| InChIKey | PSVOKKWLURFZLJ-WYEFSJPBSA-N |
| XLogP | 6.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.68 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|