C26H38O2Si — CID 134980373
(Z,2S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-2,4,6-trimethylhept-4-en-1-ol (PubChem CID 134980373) has the molecular formula C26H38O2Si and a molecular weight of 410.67 g/mol. Its IUPAC name is (Z,2S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-2,4,6-trimethylhept-4-en-1-ol.
| Compound Name | (Z,2S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-2,4,6-trimethylhept-4-en-1-ol |
|---|---|
| PubChem CID | 134980373 |
| Molecular Formula | C26H38O2Si |
| Molecular Weight | 410.67 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | (Z,2S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-2,4,6-trimethylhept-4-en-1-ol |
| SMILES | C/C(=C/[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C[C@H](C)CO |
| InChI | InChI=1S/C26H38O2Si/c1-21(17-22(2)19-27)18-23(3)20-28-29(26(4,5)6,24-13-9-7-10-14-24)25-15-11-8-12-16-25/h7-16,18,22-23,27H,17,19-20H2,1-6H3/b21-18-/t22-,23-/m0/s1 |
| InChIKey | HUJWJZSVFFSXDD-KXLVKCGUSA-N |
| XLogP | 5.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.67 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|