C21H26BrFOSi — CID 23237174
[(Z)-4-bromo-4-fluoro-2-methylbut-3-enoxy]-tert-butyl-diphenylsilane (PubChem CID 23237174) has the molecular formula C21H26BrFOSi and a molecular weight of 421.43 g/mol. Its IUPAC name is [(Z)-4-bromo-4-fluoro-2-methylbut-3-enoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(Z)-4-bromo-4-fluoro-2-methylbut-3-enoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 23237174 |
| Molecular Formula | C21H26BrFOSi |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | [(Z)-4-bromo-4-fluoro-2-methylbut-3-enoxy]-tert-butyl-diphenylsilane |
| SMILES | CC(/C=C(/F)Br)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C21H26BrFOSi/c1-17(15-20(22)23)16-24-25(21(2,3)4,18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-15,17H,16H2,1-4H3/b20-15+ |
| InChIKey | JUVSURJURTTYDJ-HMMYKYKNSA-N |
| XLogP | 5.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|