C24H34OSiZn — CID 134886533
zinc;tert-butyl-[(2S)-2-methylpent-3-enoxy]-diphenylsilane;ethane (PubChem CID 134886533) has the molecular formula C24H34OSiZn and a molecular weight of 432.01 g/mol. Its IUPAC name is zinc;tert-butyl-[(2S)-2-methylpent-3-enoxy]-diphenylsilane;ethane.
| Compound Name | zinc;tert-butyl-[(2S)-2-methylpent-3-enoxy]-diphenylsilane;ethane |
|---|---|
| PubChem CID | 134886533 |
| Molecular Formula | C24H34OSiZn |
| Molecular Weight | 432.01 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | zinc;tert-butyl-[(2S)-2-methylpent-3-enoxy]-diphenylsilane;ethane |
| SMILES | C/[C-]=C\[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.[CH2-]C.[Zn+2] |
| InChI | InChI=1S/C22H29OSi.C2H5.Zn/c1-6-13-19(2)18-23-24(22(3,4)5,20-14-9-7-10-15-20)21-16-11-8-12-17-21;1-2;/h7-17,19H,18H2,1-5H3;1H2,2H3;/q2*-1;+2/t19-;;/m0../s1 |
| InChIKey | RBPOXWDAZBJJDF-TXEPZDRESA-N |
| XLogP | 5.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.01 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|