C23H32OSiZn — CID 134886876
zinc;tert-butyl-[(2S)-2-methylpent-3-enoxy]-diphenylsilane;carbanide (PubChem CID 134886876) has the molecular formula C23H32OSiZn and a molecular weight of 417.98 g/mol. Its IUPAC name is zinc;tert-butyl-[(2S)-2-methylpent-3-enoxy]-diphenylsilane;carbanide.
| Compound Name | zinc;tert-butyl-[(2S)-2-methylpent-3-enoxy]-diphenylsilane;carbanide |
|---|---|
| PubChem CID | 134886876 |
| Molecular Formula | C23H32OSiZn |
| Molecular Weight | 417.98 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | zinc;tert-butyl-[(2S)-2-methylpent-3-enoxy]-diphenylsilane;carbanide |
| SMILES | C/[C-]=C\[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.[CH3-].[Zn+2] |
| InChI | InChI=1S/C22H29OSi.CH3.Zn/c1-6-13-19(2)18-23-24(22(3,4)5,20-14-9-7-10-15-20)21-16-11-8-12-17-21;;/h7-17,19H,18H2,1-5H3;1H3;/q2*-1;+2/t19-;;/m0../s1 |
| InChIKey | QNHWSPQLXSLOJS-TXEPZDRESA-N |
| XLogP | 5.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.98 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|