C24H33BrOSi — CID 11374218
[(Z,2S)-4-(bromomethyl)-2-methylhex-3-enoxy]-tert-butyl-diphenylsilane (PubChem CID 11374218) has the molecular formula C24H33BrOSi and a molecular weight of 445.52 g/mol. Its IUPAC name is [(Z,2S)-4-(bromomethyl)-2-methylhex-3-enoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(Z,2S)-4-(bromomethyl)-2-methylhex-3-enoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 11374218 |
| Molecular Formula | C24H33BrOSi |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | [(Z,2S)-4-(bromomethyl)-2-methylhex-3-enoxy]-tert-butyl-diphenylsilane |
| SMILES | CC/C(=C/[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CBr |
| InChI | InChI=1S/C24H33BrOSi/c1-6-21(18-25)17-20(2)19-26-27(24(3,4)5,22-13-9-7-10-14-22)23-15-11-8-12-16-23/h7-17,20H,6,18-19H2,1-5H3/b21-17-/t20-/m0/s1 |
| InChIKey | PNWQENAQOLMUPZ-HOJYTFPLSA-N |
| XLogP | 5.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|