C22H27F3OSi — CID 150355480
tert-butyl-diphenyl-[(Z,2R)-5,5,5-trifluoro-2-methylpent-3-enoxy]silane (PubChem CID 150355480) has the molecular formula C22H27F3OSi and a molecular weight of 392.54 g/mol. Its IUPAC name is tert-butyl-diphenyl-[(Z,2R)-5,5,5-trifluoro-2-methylpent-3-enoxy]silane.
| Compound Name | tert-butyl-diphenyl-[(Z,2R)-5,5,5-trifluoro-2-methylpent-3-enoxy]silane |
|---|---|
| PubChem CID | 150355480 |
| Molecular Formula | C22H27F3OSi |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | tert-butyl-diphenyl-[(Z,2R)-5,5,5-trifluoro-2-methylpent-3-enoxy]silane |
| SMILES | C[C@H](/C=C\C(F)(F)F)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C22H27F3OSi/c1-18(15-16-22(23,24)25)17-26-27(21(2,3)4,19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-16,18H,17H2,1-4H3/b16-15-/t18-/m1/s1 |
| InChIKey | GUPXAIXYVGWNHR-WBYGGXTKSA-N |
| XLogP | 5.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|