C24H32O2Si — CID 11749339
tert-butyl-[(2R,3S)-2-ethenoxy-3-methylpent-4-enoxy]-diphenylsilane (PubChem CID 11749339) has the molecular formula C24H32O2Si and a molecular weight of 380.60 g/mol. Its IUPAC name is tert-butyl-[(2R,3S)-2-ethenoxy-3-methylpent-4-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2R,3S)-2-ethenoxy-3-methylpent-4-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11749339 |
| Molecular Formula | C24H32O2Si |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | tert-butyl-[(2R,3S)-2-ethenoxy-3-methylpent-4-enoxy]-diphenylsilane |
| SMILES | C=CO[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](C)C=C |
| InChI | InChI=1S/C24H32O2Si/c1-7-20(3)23(25-8-2)19-26-27(24(4,5)6,21-15-11-9-12-16-21)22-17-13-10-14-18-22/h7-18,20,23H,1-2,19H2,3-6H3/t20-,23-/m0/s1 |
| InChIKey | WNJVZHAOZWHXGJ-REWPJTCUSA-N |
| XLogP | 4.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|