C24H34O4SSi — CID 145359387
[(2R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methylpent-4-enyl] methanesulfonate (PubChem CID 145359387) has the molecular formula C24H34O4SSi and a molecular weight of 446.69 g/mol. Its IUPAC name is [(2R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methylpent-4-enyl] methanesulfonate.
| Compound Name | [(2R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methylpent-4-enyl] methanesulfonate |
|---|---|
| PubChem CID | 145359387 |
| Molecular Formula | C24H34O4SSi |
| Molecular Weight | 446.69 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | [(2R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methylpent-4-enyl] methanesulfonate |
| SMILES | C=C[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](C)COS(C)(=O)=O |
| InChI | InChI=1S/C24H34O4SSi/c1-7-21(20(2)18-27-29(6,25)26)19-28-30(24(3,4)5,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h7-17,20-21H,1,18-19H2,2-6H3/t20-,21-/m0/s1 |
| InChIKey | GVMGEVSOTXHKQX-SFTDATJTSA-N |
| XLogP | 3.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.69 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|