C24H36O8S2Si — CID 10506738
[(3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-(2-methylsulfonyloxyethoxy)butyl] methanesulfonate (PubChem CID 10506738) has the molecular formula C24H36O8S2Si and a molecular weight of 544.76 g/mol. Its IUPAC name is [(3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-(2-methylsulfonyloxyethoxy)butyl] methanesulfonate.
| Compound Name | [(3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-(2-methylsulfonyloxyethoxy)butyl] methanesulfonate |
|---|---|
| PubChem CID | 10506738 |
| Molecular Formula | C24H36O8S2Si |
| Molecular Weight | 544.76 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | [(3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-(2-methylsulfonyloxyethoxy)butyl] methanesulfonate |
| SMILES | CC(C)(C)[Si](OC[C@H](CCOS(C)(=O)=O)OCCOS(C)(=O)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H36O8S2Si/c1-24(2,3)35(22-12-8-6-9-13-22,23-14-10-7-11-15-23)32-20-21(16-17-30-33(4,25)26)29-18-19-31-34(5,27)28/h6-15,21H,16-20H2,1-5H3/t21-/m0/s1 |
| InChIKey | WHTYYIQRXAYITE-NRFANRHFSA-N |
| XLogP | 2.29 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.76 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|