C28H44O3Si2 — CID 11420340
4-[tert-butyl(dimethyl)silyl]oxy-6-[tert-butyl(diphenyl)silyl]oxyhexanal (PubChem CID 11420340) has the molecular formula C28H44O3Si2 and a molecular weight of 484.83 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-6-[tert-butyl(diphenyl)silyl]oxyhexanal.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-6-[tert-butyl(diphenyl)silyl]oxyhexanal |
|---|---|
| PubChem CID | 11420340 |
| Molecular Formula | C28H44O3Si2 |
| Molecular Weight | 484.83 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-6-[tert-butyl(diphenyl)silyl]oxyhexanal |
| SMILES | CC(C)(C)[Si](C)(C)OC(CCC=O)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H44O3Si2/c1-27(2,3)32(7,8)31-24(16-15-22-29)21-23-30-33(28(4,5)6,25-17-11-9-12-18-25)26-19-13-10-14-20-26/h9-14,17-20,22,24H,15-16,21,23H2,1-8H3 |
| InChIKey | AGOSZUZCCPUFMD-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.83 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|