C38H49NO3Si2 — CID 72711822
tert-butyl-[3-[tert-butyl(dimethyl)silyl]oxy-4-(9H-carbazol-4-yloxy)butoxy]-diphenylsilane (PubChem CID 72711822) has the molecular formula C38H49NO3Si2 and a molecular weight of 623.99 g/mol. Its IUPAC name is tert-butyl-[3-[tert-butyl(dimethyl)silyl]oxy-4-(9H-carbazol-4-yloxy)butoxy]-diphenylsilane.
| Compound Name | tert-butyl-[3-[tert-butyl(dimethyl)silyl]oxy-4-(9H-carbazol-4-yloxy)butoxy]-diphenylsilane |
|---|---|
| PubChem CID | 72711822 |
| Molecular Formula | C38H49NO3Si2 |
| Molecular Weight | 623.99 g/mol |
| Exact Mass | 623.33 |
| IUPAC Name | tert-butyl-[3-[tert-butyl(dimethyl)silyl]oxy-4-(9H-carbazol-4-yloxy)butoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC(CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)COc1cccc2[nH]c3ccccc3c12 |
| InChI | InChI=1S/C38H49NO3Si2/c1-37(2,3)43(7,8)42-29(28-40-35-25-17-24-34-36(35)32-22-15-16-23-33(32)39-34)26-27-41-44(38(4,5)6,30-18-11-9-12-19-30)31-20-13-10-14-21-31/h9-25,29,39H,26-28H2,1-8H3 |
| InChIKey | OYPYXXYBIIJPHR-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 43.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.99 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|