C27H40O2Si2 — CID 155932039
tert-butyl-[(3S)-5-[tert-butyl(dimethyl)silyl]oxypent-1-yn-3-yl]oxy-diphenylsilane (PubChem CID 155932039) has the molecular formula C27H40O2Si2 and a molecular weight of 452.79 g/mol. Its IUPAC name is tert-butyl-[(3S)-5-[tert-butyl(dimethyl)silyl]oxypent-1-yn-3-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(3S)-5-[tert-butyl(dimethyl)silyl]oxypent-1-yn-3-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 155932039 |
| Molecular Formula | C27H40O2Si2 |
| Molecular Weight | 452.79 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | tert-butyl-[(3S)-5-[tert-butyl(dimethyl)silyl]oxypent-1-yn-3-yl]oxy-diphenylsilane |
| SMILES | C#C[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H40O2Si2/c1-10-23(21-22-28-30(8,9)26(2,3)4)29-31(27(5,6)7,24-17-13-11-14-18-24)25-19-15-12-16-20-25/h1,11-20,23H,21-22H2,2-9H3/t23-/m1/s1 |
| InChIKey | LETJIOSBQQNIDS-HSZRJFAPSA-N |
| XLogP | 5.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.79 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|