C32H52O3Si3 — CID 45258202
tert-butyl-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-2-trimethylsilyloxyhex-5-ynoxy]-diphenylsilane (PubChem CID 45258202) has the molecular formula C32H52O3Si3 and a molecular weight of 569.02 g/mol. Its IUPAC name is tert-butyl-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-2-trimethylsilyloxyhex-5-ynoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-2-trimethylsilyloxyhex-5-ynoxy]-diphenylsilane |
|---|---|
| PubChem CID | 45258202 |
| Molecular Formula | C32H52O3Si3 |
| Molecular Weight | 569.02 g/mol |
| Exact Mass | 568.32 |
| IUPAC Name | tert-butyl-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-2-trimethylsilyloxyhex-5-ynoxy]-diphenylsilane |
| SMILES | C#C[C@@H](C[C@@](C)(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H52O3Si3/c1-14-27(34-37(12,13)30(2,3)4)25-32(8,35-36(9,10)11)26-33-38(31(5,6)7,28-21-17-15-18-22-28)29-23-19-16-20-24-29/h1,15-24,27H,25-26H2,2-13H3/t27-,32-/m0/s1 |
| InChIKey | JGBQDWMCNRCCFG-UCGGBYDDSA-N |
| XLogP | 7.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.02 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|