C48H76O4Si3 — CID 164671859
[(5S,9R)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-13-phenylmethoxytridec-6-ynoxy]-tert-butyl-diphenylsilane (PubChem CID 164671859) has the molecular formula C48H76O4Si3 and a molecular weight of 801.39 g/mol. Its IUPAC name is [(5S,9R)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-13-phenylmethoxytridec-6-ynoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(5S,9R)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-13-phenylmethoxytridec-6-ynoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 164671859 |
| Molecular Formula | C48H76O4Si3 |
| Molecular Weight | 801.39 g/mol |
| Exact Mass | 800.51 |
| IUPAC Name | [(5S,9R)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-13-phenylmethoxytridec-6-ynoxy]-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CC#C[C@H](CCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[Si](C)(C)C(C)(C)C)CCCCOCc1ccccc1 |
| InChI | InChI=1S/C48H76O4Si3/c1-46(2,3)53(10,11)51-42(30-23-25-38-49-40-41-28-17-14-18-29-41)32-27-33-43(52-54(12,13)47(4,5)6)31-24-26-39-50-55(48(7,8)9,44-34-19-15-20-35-44)45-36-21-16-22-37-45/h14-22,28-29,34-37,42-43H,23-26,30-32,38-40H2,1-13H3/t42-,43+/m1/s1 |
| InChIKey | JRKMQXCRSZULLF-QAZBPYKKSA-N |
| XLogP | 12.29 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.39 |
| LogP ≤ 5 | 12.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|