C33H54O4Si2 — CID 24938591
tert-butyl-[(5S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)non-8-enoxy]-diphenylsilane (PubChem CID 24938591) has the molecular formula C33H54O4Si2 and a molecular weight of 570.96 g/mol. Its IUPAC name is tert-butyl-[(5S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)non-8-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(5S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)non-8-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 24938591 |
| Molecular Formula | C33H54O4Si2 |
| Molecular Weight | 570.96 g/mol |
| Exact Mass | 570.36 |
| IUPAC Name | tert-butyl-[(5S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)non-8-enoxy]-diphenylsilane |
| SMILES | C=C[C@@H](C[C@H](CCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCOC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H54O4Si2/c1-11-28(37-38(9,10)32(2,3)4)26-29(35-27-34-8)20-18-19-25-36-39(33(5,6)7,30-21-14-12-15-22-30)31-23-16-13-17-24-31/h11-17,21-24,28-29H,1,18-20,25-27H2,2-10H3/t28-,29-/m0/s1 |
| InChIKey | TYLUIFOEZGERBX-VMPREFPWSA-N |
| XLogP | 7.69 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.96 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|