C31H48O2Si2 — CID 11364212
tert-butyl-[(3E)-9-[tert-butyl(dimethyl)silyl]oxynona-1,3-dien-5-yl]oxy-diphenylsilane (PubChem CID 11364212) has the molecular formula C31H48O2Si2 and a molecular weight of 508.90 g/mol. Its IUPAC name is tert-butyl-[(3E)-9-[tert-butyl(dimethyl)silyl]oxynona-1,3-dien-5-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(3E)-9-[tert-butyl(dimethyl)silyl]oxynona-1,3-dien-5-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 11364212 |
| Molecular Formula | C31H48O2Si2 |
| Molecular Weight | 508.90 g/mol |
| Exact Mass | 508.32 |
| IUPAC Name | tert-butyl-[(3E)-9-[tert-butyl(dimethyl)silyl]oxynona-1,3-dien-5-yl]oxy-diphenylsilane |
| SMILES | C=C/C=C/C(CCCCO[Si](C)(C)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H48O2Si2/c1-10-11-20-27(21-18-19-26-32-34(8,9)30(2,3)4)33-35(31(5,6)7,28-22-14-12-15-23-28)29-24-16-13-17-25-29/h10-17,20,22-25,27H,1,18-19,21,26H2,2-9H3/b20-11+ |
| InChIKey | SQSYKFLDKCCTCJ-RGVLZGJSSA-N |
| XLogP | 7.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.90 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|