C33H54O3Si2 — CID 58750459
(Z,4S,9R)-1-[tert-butyl(dimethyl)silyl]oxy-9-[tert-butyl(diphenyl)silyl]oxy-4-methyldec-6-en-5-ol (PubChem CID 58750459) has the molecular formula C33H54O3Si2 and a molecular weight of 554.96 g/mol. Its IUPAC name is (Z,4S,9R)-1-[tert-butyl(dimethyl)silyl]oxy-9-[tert-butyl(diphenyl)silyl]oxy-4-methyldec-6-en-5-ol.
| Compound Name | (Z,4S,9R)-1-[tert-butyl(dimethyl)silyl]oxy-9-[tert-butyl(diphenyl)silyl]oxy-4-methyldec-6-en-5-ol |
|---|---|
| PubChem CID | 58750459 |
| Molecular Formula | C33H54O3Si2 |
| Molecular Weight | 554.96 g/mol |
| Exact Mass | 554.36 |
| IUPAC Name | (Z,4S,9R)-1-[tert-butyl(dimethyl)silyl]oxy-9-[tert-butyl(diphenyl)silyl]oxy-4-methyldec-6-en-5-ol |
| SMILES | C[C@H](C/C=C\C(O)[C@@H](C)CCCO[Si](C)(C)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H54O3Si2/c1-27(19-18-26-35-37(9,10)32(3,4)5)31(34)25-17-20-28(2)36-38(33(6,7)8,29-21-13-11-14-22-29)30-23-15-12-16-24-30/h11-17,21-25,27-28,31,34H,18-20,26H2,1-10H3/b25-17-/t27-,28+,31?/m0/s1 |
| InChIKey | CSHJYSLQKQRWFD-RLWSAIONSA-N |
| XLogP | 7.70 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.96 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|